N-[(2-ethoxyphenyl)methyl]-4-(4-methyl-1-oxo[1]benzothieno[2,3-d]pyridazin-2(1H)-yl)butanamide
Chemical Structure Depiction of
N-[(2-ethoxyphenyl)methyl]-4-(4-methyl-1-oxo[1]benzothieno[2,3-d]pyridazin-2(1H)-yl)butanamide
N-[(2-ethoxyphenyl)methyl]-4-(4-methyl-1-oxo[1]benzothieno[2,3-d]pyridazin-2(1H)-yl)butanamide
Compound characteristics
| Compound ID: | E019-1138 |
| Compound Name: | N-[(2-ethoxyphenyl)methyl]-4-(4-methyl-1-oxo[1]benzothieno[2,3-d]pyridazin-2(1H)-yl)butanamide |
| Molecular Weight: | 435.54 |
| Molecular Formula: | C24 H25 N3 O3 S |
| Smiles: | CCOc1ccccc1CNC(CCCN1C(c2c3ccccc3sc2C(C)=N1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8561 |
| logD: | 3.8561 |
| logSw: | -4.0755 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.047 |
| InChI Key: | DDCRRHUGKCTKML-UHFFFAOYSA-N |