N-(3-methoxyphenyl)-2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2(1H)-yl)acetamide
Chemical Structure Depiction of
N-(3-methoxyphenyl)-2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2(1H)-yl)acetamide
N-(3-methoxyphenyl)-2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2(1H)-yl)acetamide
Compound characteristics
| Compound ID: | E020-0384 |
| Compound Name: | N-(3-methoxyphenyl)-2-(4-methyl-1-oxopyrrolo[1,2-d][1,2,4]triazin-2(1H)-yl)acetamide |
| Molecular Weight: | 312.33 |
| Molecular Formula: | C16 H16 N4 O3 |
| Smiles: | CC1=NN(CC(Nc2cccc(c2)OC)=O)C(c2cccn12)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1982 |
| logD: | 2.1982 |
| logSw: | -2.8776 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.992 |
| InChI Key: | HUBHQLICPOCQNW-UHFFFAOYSA-N |