7-[2-(azepan-1-yl)ethyl]-N-cyclohexyl-6-methyl-8-oxo-5,6,7,8-tetrahydrothieno[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
Chemical Structure Depiction of
7-[2-(azepan-1-yl)ethyl]-N-cyclohexyl-6-methyl-8-oxo-5,6,7,8-tetrahydrothieno[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
7-[2-(azepan-1-yl)ethyl]-N-cyclohexyl-6-methyl-8-oxo-5,6,7,8-tetrahydrothieno[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
Compound characteristics
| Compound ID: | E021-0114 |
| Compound Name: | 7-[2-(azepan-1-yl)ethyl]-N-cyclohexyl-6-methyl-8-oxo-5,6,7,8-tetrahydrothieno[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide |
| Molecular Weight: | 456.65 |
| Molecular Formula: | C25 H36 N4 O2 S |
| Smiles: | CC1(Cn2c(cc3c2ccs3)C(N1CCN1CCCCCC1)=O)C(NC1CCCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5669 |
| logD: | 3.9841 |
| logSw: | -4.2278 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.047 |
| InChI Key: | QQQFYINIAQEQJW-VWLOTQADSA-N |