N-cyclooctyl-7-[(2-methoxyphenyl)methyl]-6-methyl-8-oxo-5,6,7,8-tetrahydrothieno[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
Chemical Structure Depiction of
N-cyclooctyl-7-[(2-methoxyphenyl)methyl]-6-methyl-8-oxo-5,6,7,8-tetrahydrothieno[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
N-cyclooctyl-7-[(2-methoxyphenyl)methyl]-6-methyl-8-oxo-5,6,7,8-tetrahydrothieno[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
Compound characteristics
| Compound ID: | E021-0679 |
| Compound Name: | N-cyclooctyl-7-[(2-methoxyphenyl)methyl]-6-methyl-8-oxo-5,6,7,8-tetrahydrothieno[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide |
| Molecular Weight: | 479.64 |
| Molecular Formula: | C27 H33 N3 O3 S |
| Smiles: | CC1(Cn2c(cc3c2ccs3)C(N1Cc1ccccc1OC)=O)C(NC1CCCCCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.9381 |
| logD: | 5.9381 |
| logSw: | -5.3577 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.717 |
| InChI Key: | BSGMWHPNMILYGN-MHZLTWQESA-N |