N-[(3-chlorophenyl)methyl]-2-(3-oxo-1,2-benzothiazol-2(3H)-yl)propanamide
Chemical Structure Depiction of
N-[(3-chlorophenyl)methyl]-2-(3-oxo-1,2-benzothiazol-2(3H)-yl)propanamide
N-[(3-chlorophenyl)methyl]-2-(3-oxo-1,2-benzothiazol-2(3H)-yl)propanamide
Compound characteristics
| Compound ID: | E022-0662 |
| Compound Name: | N-[(3-chlorophenyl)methyl]-2-(3-oxo-1,2-benzothiazol-2(3H)-yl)propanamide |
| Molecular Weight: | 346.83 |
| Molecular Formula: | C17 H15 Cl N2 O2 S |
| Smiles: | CC(C(NCc1cccc(c1)[Cl])=O)N1C(c2ccccc2S1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.076 |
| logD: | 3.076 |
| logSw: | -3.6844 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.213 |
| InChI Key: | IUZHGKNPLDSBGJ-NSHDSACASA-N |