N-[(2-ethoxyphenyl)methyl]-2-(3-oxo-1,2-benzothiazol-2(3H)-yl)propanamide
Chemical Structure Depiction of
N-[(2-ethoxyphenyl)methyl]-2-(3-oxo-1,2-benzothiazol-2(3H)-yl)propanamide
N-[(2-ethoxyphenyl)methyl]-2-(3-oxo-1,2-benzothiazol-2(3H)-yl)propanamide
Compound characteristics
| Compound ID: | E022-0905 |
| Compound Name: | N-[(2-ethoxyphenyl)methyl]-2-(3-oxo-1,2-benzothiazol-2(3H)-yl)propanamide |
| Molecular Weight: | 356.44 |
| Molecular Formula: | C19 H20 N2 O3 S |
| Smiles: | CCOc1ccccc1CNC(C(C)N1C(c2ccccc2S1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9881 |
| logD: | 2.9881 |
| logSw: | -3.489 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.423 |
| InChI Key: | QSKSJVPYGHICMH-ZDUSSCGKSA-N |