N-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)-2-methyl-1,1-dioxo-1,2-dihydro-1lambda~6~,2,6-thiadiazine-3-carboxamide
					Chemical Structure Depiction of
N-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)-2-methyl-1,1-dioxo-1,2-dihydro-1lambda~6~,2,6-thiadiazine-3-carboxamide
			N-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)-2-methyl-1,1-dioxo-1,2-dihydro-1lambda~6~,2,6-thiadiazine-3-carboxamide
Compound characteristics
| Compound ID: | E135-0306 | 
| Compound Name: | N-(3,4-dimethoxyphenyl)-5-(3-methoxyphenyl)-2-methyl-1,1-dioxo-1,2-dihydro-1lambda~6~,2,6-thiadiazine-3-carboxamide | 
| Molecular Weight: | 431.47 | 
| Molecular Formula: | C20 H21 N3 O6 S | 
| Smiles: | CN1C(=CC(c2cccc(c2)OC)=NS1(=O)=O)C(Nc1ccc(c(c1)OC)OC)=O | 
| Stereo: | ACHIRAL | 
| logP: | 2.3965 | 
| logD: | 1.7122 | 
| logSw: | -3.1236 | 
| Hydrogen bond acceptors count: | 10 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 91.123 | 
| InChI Key: | IUOYADUDUQNJNW-UHFFFAOYSA-N | 
 
				 
				