5-(3,4-dimethoxyphenyl)-2-methyl-N-(2-methylpropyl)-1,1-dioxo-1,2-dihydro-1lambda~6~,2,6-thiadiazine-3-carboxamide
Chemical Structure Depiction of
5-(3,4-dimethoxyphenyl)-2-methyl-N-(2-methylpropyl)-1,1-dioxo-1,2-dihydro-1lambda~6~,2,6-thiadiazine-3-carboxamide
5-(3,4-dimethoxyphenyl)-2-methyl-N-(2-methylpropyl)-1,1-dioxo-1,2-dihydro-1lambda~6~,2,6-thiadiazine-3-carboxamide
Compound characteristics
| Compound ID: | E135-0810 |
| Compound Name: | 5-(3,4-dimethoxyphenyl)-2-methyl-N-(2-methylpropyl)-1,1-dioxo-1,2-dihydro-1lambda~6~,2,6-thiadiazine-3-carboxamide |
| Molecular Weight: | 381.45 |
| Molecular Formula: | C17 H23 N3 O5 S |
| Smiles: | CC(C)CNC(C1=CC(c2ccc(c(c2)OC)OC)=NS(N1C)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.7187 |
| logD: | 1.7187 |
| logSw: | -2.6195 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.173 |
| InChI Key: | LMYNFTZVWRJQFB-UHFFFAOYSA-N |