N-(3-methylphenyl)-1,3-diphenyl-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
N-(3-methylphenyl)-1,3-diphenyl-1H-pyrazole-4-carboxamide
N-(3-methylphenyl)-1,3-diphenyl-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | E136-0225 |
| Compound Name: | N-(3-methylphenyl)-1,3-diphenyl-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 353.42 |
| Molecular Formula: | C23 H19 N3 O |
| Smiles: | Cc1cccc(c1)NC(c1cn(c2ccccc2)nc1c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8597 |
| logD: | 4.8597 |
| logSw: | -4.4779 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.962 |
| InChI Key: | ALCYRTJAWJYDPJ-UHFFFAOYSA-N |