methyl 1-methyl-4-[(3,4,5-trimethoxyphenyl)sulfamoyl]-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 1-methyl-4-[(3,4,5-trimethoxyphenyl)sulfamoyl]-1H-pyrrole-2-carboxylate
methyl 1-methyl-4-[(3,4,5-trimethoxyphenyl)sulfamoyl]-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | E138-1002 |
| Compound Name: | methyl 1-methyl-4-[(3,4,5-trimethoxyphenyl)sulfamoyl]-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 384.41 |
| Molecular Formula: | C16 H20 N2 O7 S |
| Smiles: | Cn1cc(cc1C(=O)OC)S(Nc1cc(c(c(c1)OC)OC)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.8243 |
| logD: | 0.6427 |
| logSw: | -2.2879 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.35 |
| InChI Key: | IWLBVUBOYVAHQG-UHFFFAOYSA-N |