2-(2-methoxyphenyl)-3,5-dihydro-4H-[1]benzopyrano[2,3-d]pyrimidin-4-one
Chemical Structure Depiction of
2-(2-methoxyphenyl)-3,5-dihydro-4H-[1]benzopyrano[2,3-d]pyrimidin-4-one
2-(2-methoxyphenyl)-3,5-dihydro-4H-[1]benzopyrano[2,3-d]pyrimidin-4-one
Compound characteristics
| Compound ID: | E139-0011 |
| Compound Name: | 2-(2-methoxyphenyl)-3,5-dihydro-4H-[1]benzopyrano[2,3-d]pyrimidin-4-one |
| Molecular Weight: | 306.32 |
| Molecular Formula: | C18 H14 N2 O3 |
| Smiles: | COc1ccccc1C1NC(C2Cc3ccccc3OC=2N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8689 |
| logD: | 1.8968 |
| logSw: | -3.7235 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.347 |
| InChI Key: | CNUNXKSAXHEXAJ-UHFFFAOYSA-N |