N-(4-chlorophenyl)-5-methyl-1-phenyl-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-5-methyl-1-phenyl-1H-1,2,3-triazole-4-carboxamide
N-(4-chlorophenyl)-5-methyl-1-phenyl-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | E141-0005 |
| Compound Name: | N-(4-chlorophenyl)-5-methyl-1-phenyl-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 312.76 |
| Molecular Formula: | C16 H13 Cl N4 O |
| Smiles: | Cc1c(C(Nc2ccc(cc2)[Cl])=O)nnn1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.3437 |
| logD: | 3.3395 |
| logSw: | -3.7974 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.173 |
| InChI Key: | WPLIKLKPCKTXBU-UHFFFAOYSA-N |