N-(3-chloro-4-methoxyphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]-1H-1,2,3-triazole-4-carboxamide
					Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]-1H-1,2,3-triazole-4-carboxamide
			N-(3-chloro-4-methoxyphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | E141-0236 | 
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]-1H-1,2,3-triazole-4-carboxamide | 
| Molecular Weight: | 410.78 | 
| Molecular Formula: | C18 H14 Cl F3 N4 O2 | 
| Smiles: | Cc1c(C(Nc2ccc(c(c2)[Cl])OC)=O)nnn1c1cccc(c1)C(F)(F)F | 
| Stereo: | ACHIRAL | 
| logP: | 4.2328 | 
| logD: | 4.2221 | 
| logSw: | -4.6865 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 57.803 | 
| InChI Key: | VOBCVAKJCFCNPK-UHFFFAOYSA-N | 
 
				 
				