N-(4-fluorophenyl)-N-methyl-4H-[1]benzopyrano[3,4-d][1,2]oxazole-3-carboxamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-N-methyl-4H-[1]benzopyrano[3,4-d][1,2]oxazole-3-carboxamide
N-(4-fluorophenyl)-N-methyl-4H-[1]benzopyrano[3,4-d][1,2]oxazole-3-carboxamide
Compound characteristics
| Compound ID: | E146-0478 |
| Compound Name: | N-(4-fluorophenyl)-N-methyl-4H-[1]benzopyrano[3,4-d][1,2]oxazole-3-carboxamide |
| Molecular Weight: | 324.31 |
| Molecular Formula: | C18 H13 F N2 O3 |
| Smiles: | CN(C(c1c2COc3ccccc3c2on1)=O)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 2.9754 |
| logD: | 2.9754 |
| logSw: | -3.4984 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.138 |
| InChI Key: | AUGPHDQPLMIXJU-UHFFFAOYSA-N |