N-(3-chloro-4-methoxyphenyl)-4H-[1]benzothiopyrano[3,4-d][1,2]oxazole-3-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-4H-[1]benzothiopyrano[3,4-d][1,2]oxazole-3-carboxamide
N-(3-chloro-4-methoxyphenyl)-4H-[1]benzothiopyrano[3,4-d][1,2]oxazole-3-carboxamide
Compound characteristics
| Compound ID: | E146-0801 |
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-4H-[1]benzothiopyrano[3,4-d][1,2]oxazole-3-carboxamide |
| Molecular Weight: | 372.83 |
| Molecular Formula: | C18 H13 Cl N2 O3 S |
| Smiles: | COc1ccc(cc1[Cl])NC(c1c2CSc3ccccc3c2on1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3575 |
| logD: | 4.3544 |
| logSw: | -4.5333 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.041 |
| InChI Key: | LKLDNGYNFPVTPG-UHFFFAOYSA-N |