3,4,5-trimethoxy-N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide
Chemical Structure Depiction of
3,4,5-trimethoxy-N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide
3,4,5-trimethoxy-N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | E153-0125 |
| Compound Name: | 3,4,5-trimethoxy-N-[3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide |
| Molecular Weight: | 421.47 |
| Molecular Formula: | C22 H19 N3 O4 S |
| Smiles: | COc1cc(cc(c1OC)OC)C(Nc1cccc(c1)c1nc2cccnc2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.252 |
| logD: | 4.252 |
| logSw: | -4.45 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.162 |
| InChI Key: | IQGMYLAITMBQAE-UHFFFAOYSA-N |