2-(4-chlorophenyl)-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]acetamide
Chemical Structure Depiction of
2-(4-chlorophenyl)-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]acetamide
2-(4-chlorophenyl)-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]acetamide
Compound characteristics
| Compound ID: | E153-0429 |
| Compound Name: | 2-(4-chlorophenyl)-N-[2-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]acetamide |
| Molecular Weight: | 393.89 |
| Molecular Formula: | C21 H16 Cl N3 O S |
| Smiles: | Cc1c(cccc1NC(Cc1ccc(cc1)[Cl])=O)c1nc2cccnc2s1 |
| Stereo: | ACHIRAL |
| logP: | 4.7879 |
| logD: | 4.7878 |
| logSw: | -4.9074 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.273 |
| InChI Key: | RJBZPICECMNGPZ-UHFFFAOYSA-N |