N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide
Chemical Structure Depiction of
N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide
N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | E153-0527 |
| Compound Name: | N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]benzamide |
| Molecular Weight: | 345.42 |
| Molecular Formula: | C20 H15 N3 O S |
| Smiles: | Cc1ccc(cc1NC(c1ccccc1)=O)c1nc2cccnc2s1 |
| Stereo: | ACHIRAL |
| logP: | 4.3457 |
| logD: | 4.3456 |
| logSw: | -4.2789 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.486 |
| InChI Key: | BORXWPQRKVAGJO-UHFFFAOYSA-N |