N~1~-[2-(2,3-dihydro-1H-indol-1-yl)-2-(pyridin-3-yl)ethyl]-N~2~-(3-methoxyphenyl)ethanediamide
Chemical Structure Depiction of
N~1~-[2-(2,3-dihydro-1H-indol-1-yl)-2-(pyridin-3-yl)ethyl]-N~2~-(3-methoxyphenyl)ethanediamide
N~1~-[2-(2,3-dihydro-1H-indol-1-yl)-2-(pyridin-3-yl)ethyl]-N~2~-(3-methoxyphenyl)ethanediamide
Compound characteristics
| Compound ID: | E155-0968 |
| Compound Name: | N~1~-[2-(2,3-dihydro-1H-indol-1-yl)-2-(pyridin-3-yl)ethyl]-N~2~-(3-methoxyphenyl)ethanediamide |
| Molecular Weight: | 416.48 |
| Molecular Formula: | C24 H24 N4 O3 |
| Smiles: | COc1cccc(c1)NC(C(NCC(c1cccnc1)N1CCc2ccccc12)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6671 |
| logD: | 2.1645 |
| logSw: | -2.9206 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.096 |
| InChI Key: | JNFKGLSLWSMBEA-QFIPXVFZSA-N |