N-[3-(3-methoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]furan-2-carboxamide
Chemical Structure Depiction of
N-[3-(3-methoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]furan-2-carboxamide
N-[3-(3-methoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]furan-2-carboxamide
Compound characteristics
| Compound ID: | E157-3315 |
| Compound Name: | N-[3-(3-methoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]furan-2-carboxamide |
| Molecular Weight: | 341.35 |
| Molecular Formula: | C15 H11 N5 O3 S |
| Smiles: | COc1cccc(c1)c1nnc2n1nc(NC(c1ccco1)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 2.6356 |
| logD: | 2.6255 |
| logSw: | -3.2663 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.247 |
| InChI Key: | CXJHUPKPFVFNFQ-UHFFFAOYSA-N |