4-methoxy-N-{5-[methyl(phenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl}benzamide
Chemical Structure Depiction of
4-methoxy-N-{5-[methyl(phenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl}benzamide
4-methoxy-N-{5-[methyl(phenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl}benzamide
Compound characteristics
| Compound ID: | E157-5447 |
| Compound Name: | 4-methoxy-N-{5-[methyl(phenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl}benzamide |
| Molecular Weight: | 404.46 |
| Molecular Formula: | C17 H16 N4 O4 S2 |
| Smiles: | CN(c1ccccc1)S(c1nnc(NC(c2ccc(cc2)OC)=O)s1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4164 |
| logD: | 2.3199 |
| logSw: | -3.8579 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.014 |
| InChI Key: | WGMWFQJFEWZSBR-UHFFFAOYSA-N |