N-{5-[ethyl(4-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl}-3-methoxybenzamide
Chemical Structure Depiction of
N-{5-[ethyl(4-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl}-3-methoxybenzamide
N-{5-[ethyl(4-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl}-3-methoxybenzamide
Compound characteristics
| Compound ID: | E157-6346 |
| Compound Name: | N-{5-[ethyl(4-methylphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl}-3-methoxybenzamide |
| Molecular Weight: | 432.52 |
| Molecular Formula: | C19 H20 N4 O4 S2 |
| Smiles: | CCN(c1ccc(C)cc1)S(c1nnc(NC(c2cccc(c2)OC)=O)s1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2031 |
| logD: | 3.3766 |
| logSw: | -4.2737 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.743 |
| InChI Key: | ZDQHJEYAVFVMKD-UHFFFAOYSA-N |