N-(2-methoxyphenyl)-2-{[3-(3-methylbutyl)-4-oxo-3,4-dihydropteridin-2-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(2-methoxyphenyl)-2-{[3-(3-methylbutyl)-4-oxo-3,4-dihydropteridin-2-yl]sulfanyl}acetamide
N-(2-methoxyphenyl)-2-{[3-(3-methylbutyl)-4-oxo-3,4-dihydropteridin-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | E196-0223 |
| Compound Name: | N-(2-methoxyphenyl)-2-{[3-(3-methylbutyl)-4-oxo-3,4-dihydropteridin-2-yl]sulfanyl}acetamide |
| Molecular Weight: | 413.5 |
| Molecular Formula: | C20 H23 N5 O3 S |
| Smiles: | CC(C)CCN1C(=Nc2c(C1=O)nccn2)SCC(Nc1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7971 |
| logD: | 2.797 |
| logSw: | -3.3654 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.635 |
| InChI Key: | YKJZTIWJIBQZID-UHFFFAOYSA-N |