5-acetyl-N-(4-ethoxyphenyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide
Chemical Structure Depiction of
5-acetyl-N-(4-ethoxyphenyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide
5-acetyl-N-(4-ethoxyphenyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide
Compound characteristics
| Compound ID: | E199-0277 |
| Compound Name: | 5-acetyl-N-(4-ethoxyphenyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| Molecular Weight: | 300.36 |
| Molecular Formula: | C17 H20 N2 O3 |
| Smiles: | CCOc1ccc(cc1)NC(c1c(C)c(C(C)=O)[nH]c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9467 |
| logD: | 2.9464 |
| logSw: | -3.3633 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.261 |
| InChI Key: | QULZUAFWTIIKKR-UHFFFAOYSA-N |