N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(4-methylphenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Chemical Structure Depiction of
N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(4-methylphenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide
N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(4-methylphenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | E200-0116 |
| Compound Name: | N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(4-methylphenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide |
| Molecular Weight: | 407.32 |
| Molecular Formula: | C19 H13 F4 N3 O3 |
| Smiles: | Cc1ccc(cc1)N1C(C(=CNC1=O)C(Nc1ccc(c(c1)C(F)(F)F)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6341 |
| logD: | 0.742 |
| logSw: | -3.9528 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.849 |
| InChI Key: | WQDAKLHYSOFUHL-UHFFFAOYSA-N |