methyl 4-{[3-(4-methoxyphenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonyl]amino}benzoate
Chemical Structure Depiction of
methyl 4-{[3-(4-methoxyphenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonyl]amino}benzoate
methyl 4-{[3-(4-methoxyphenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonyl]amino}benzoate
Compound characteristics
| Compound ID: | E200-0155 |
| Compound Name: | methyl 4-{[3-(4-methoxyphenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonyl]amino}benzoate |
| Molecular Weight: | 395.37 |
| Molecular Formula: | C20 H17 N3 O6 |
| Smiles: | COC(c1ccc(cc1)NC(C1=CNC(N(C1=O)c1ccc(cc1)OC)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2348 |
| logD: | 1.7047 |
| logSw: | -2.8922 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 91.566 |
| InChI Key: | GPMWJWDIWADEHI-UHFFFAOYSA-N |