N-butyl-1,9-dimethyl-4-oxo-N-phenyl-1,4-dihydropyrido[1,2-a]pyrrolo[2,3-d]pyrimidine-2-carboxamide
Chemical Structure Depiction of
N-butyl-1,9-dimethyl-4-oxo-N-phenyl-1,4-dihydropyrido[1,2-a]pyrrolo[2,3-d]pyrimidine-2-carboxamide
N-butyl-1,9-dimethyl-4-oxo-N-phenyl-1,4-dihydropyrido[1,2-a]pyrrolo[2,3-d]pyrimidine-2-carboxamide
Compound characteristics
| Compound ID: | E201-0301 |
| Compound Name: | N-butyl-1,9-dimethyl-4-oxo-N-phenyl-1,4-dihydropyrido[1,2-a]pyrrolo[2,3-d]pyrimidine-2-carboxamide |
| Molecular Weight: | 388.47 |
| Molecular Formula: | C23 H24 N4 O2 |
| Smiles: | CCCCN(C(c1cc2C(N3C=CC=C(C)C3=Nc2n1C)=O)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.9538 |
| logD: | 3.9538 |
| logSw: | -3.8491 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 42.024 |
| InChI Key: | AFTWCSIYCIQLKU-UHFFFAOYSA-N |