N-(2,3-dimethylcyclohexyl)-1-methyl-4-(morpholine-4-sulfonyl)-1H-pyrrole-2-carboxamide
Chemical Structure Depiction of
N-(2,3-dimethylcyclohexyl)-1-methyl-4-(morpholine-4-sulfonyl)-1H-pyrrole-2-carboxamide
N-(2,3-dimethylcyclohexyl)-1-methyl-4-(morpholine-4-sulfonyl)-1H-pyrrole-2-carboxamide
Compound characteristics
| Compound ID: | E203-0682 |
| Compound Name: | N-(2,3-dimethylcyclohexyl)-1-methyl-4-(morpholine-4-sulfonyl)-1H-pyrrole-2-carboxamide |
| Molecular Weight: | 383.51 |
| Molecular Formula: | C18 H29 N3 O4 S |
| Smiles: | CC1CCCC(C1C)NC(c1cc(cn1C)S(N1CCOCC1)(=O)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 1.4427 |
| logD: | 1.4427 |
| logSw: | -2.3094 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.697 |
| InChI Key: | UEOICFQNELFYSY-UHFFFAOYSA-N |