4-(2,3-dihydro-1H-indole-1-sulfonyl)-N-(2,5-dimethylphenyl)-1-methyl-1H-pyrrole-2-carboxamide
Chemical Structure Depiction of
4-(2,3-dihydro-1H-indole-1-sulfonyl)-N-(2,5-dimethylphenyl)-1-methyl-1H-pyrrole-2-carboxamide
4-(2,3-dihydro-1H-indole-1-sulfonyl)-N-(2,5-dimethylphenyl)-1-methyl-1H-pyrrole-2-carboxamide
Compound characteristics
| Compound ID: | E203-1120 |
| Compound Name: | 4-(2,3-dihydro-1H-indole-1-sulfonyl)-N-(2,5-dimethylphenyl)-1-methyl-1H-pyrrole-2-carboxamide |
| Molecular Weight: | 409.51 |
| Molecular Formula: | C22 H23 N3 O3 S |
| Smiles: | Cc1ccc(C)c(c1)NC(c1cc(cn1C)S(N1CCc2ccccc12)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2328 |
| logD: | 3.2326 |
| logSw: | -3.5287 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.46 |
| InChI Key: | JOOCZZKZBJJBBS-UHFFFAOYSA-N |