4-acetyl-N-(2,5-dimethoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide
Chemical Structure Depiction of
4-acetyl-N-(2,5-dimethoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide
4-acetyl-N-(2,5-dimethoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide
Compound characteristics
| Compound ID: | E204-0106 |
| Compound Name: | 4-acetyl-N-(2,5-dimethoxyphenyl)-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide |
| Molecular Weight: | 392.43 |
| Molecular Formula: | C18 H20 N2 O6 S |
| Smiles: | CC(N1CCOc2ccc(cc12)S(Nc1cc(ccc1OC)OC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1123 |
| logD: | 1.7101 |
| logSw: | -3.0209 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.368 |
| InChI Key: | DZPJNSOGDAGPLC-UHFFFAOYSA-N |