4-acetyl-N-(2-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide
Chemical Structure Depiction of
4-acetyl-N-(2-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide
4-acetyl-N-(2-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide
Compound characteristics
| Compound ID: | E204-0198 |
| Compound Name: | 4-acetyl-N-(2-chlorophenyl)-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide |
| Molecular Weight: | 366.82 |
| Molecular Formula: | C16 H15 Cl N2 O4 S |
| Smiles: | CC(N1CCOc2ccc(cc12)S(Nc1ccccc1[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5117 |
| logD: | 2.3532 |
| logSw: | -3.2616 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.194 |
| InChI Key: | PDQXIUVPSDFDOK-UHFFFAOYSA-N |