N-(3-chlorophenyl)-N-ethyl-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-N-ethyl-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-4-carboxamide
N-(3-chlorophenyl)-N-ethyl-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | E207-0107 |
| Compound Name: | N-(3-chlorophenyl)-N-ethyl-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine-4-carboxamide |
| Molecular Weight: | 440.93 |
| Molecular Formula: | C23 H25 Cl N4 O3 |
| Smiles: | CCN(C(C1CCN(CC1)c1nc(c2ccc(cc2)OC)no1)=O)c1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.147 |
| logD: | 5.147 |
| logSw: | -5.6939 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 58.331 |
| InChI Key: | GBTDPGUQNGBSBZ-UHFFFAOYSA-N |