2-(1,2-benzoxazol-3-yl)-N-(5-chloro-2-methoxyphenyl)-N-methylacetamide
Chemical Structure Depiction of
2-(1,2-benzoxazol-3-yl)-N-(5-chloro-2-methoxyphenyl)-N-methylacetamide
2-(1,2-benzoxazol-3-yl)-N-(5-chloro-2-methoxyphenyl)-N-methylacetamide
Compound characteristics
| Compound ID: | E207-0392 |
| Compound Name: | 2-(1,2-benzoxazol-3-yl)-N-(5-chloro-2-methoxyphenyl)-N-methylacetamide |
| Molecular Weight: | 330.77 |
| Molecular Formula: | C17 H15 Cl N2 O3 |
| Smiles: | CN(C(Cc1c2ccccc2on1)=O)c1cc(ccc1OC)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.5125 |
| logD: | 3.5125 |
| logSw: | -3.9003 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.104 |
| InChI Key: | GGGAPLCHRWDDJI-UHFFFAOYSA-N |