2-(1,2-benzoxazol-3-yl)-N-{3-[4-(4-fluorophenyl)piperazin-1-yl]propyl}acetamide
Chemical Structure Depiction of
2-(1,2-benzoxazol-3-yl)-N-{3-[4-(4-fluorophenyl)piperazin-1-yl]propyl}acetamide
2-(1,2-benzoxazol-3-yl)-N-{3-[4-(4-fluorophenyl)piperazin-1-yl]propyl}acetamide
Compound characteristics
| Compound ID: | E207-0446 |
| Compound Name: | 2-(1,2-benzoxazol-3-yl)-N-{3-[4-(4-fluorophenyl)piperazin-1-yl]propyl}acetamide |
| Molecular Weight: | 396.46 |
| Molecular Formula: | C22 H25 F N4 O2 |
| Smiles: | C(CNC(Cc1c2ccccc2on1)=O)CN1CCN(CC1)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 2.7047 |
| logD: | 2.1186 |
| logSw: | -2.8907 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.217 |
| InChI Key: | UARUPWRENRNYCF-UHFFFAOYSA-N |