N-(4-bromophenyl)-N-methyl-2-(5-methyl-1,2-benzoxazol-3-yl)acetamide
Chemical Structure Depiction of
N-(4-bromophenyl)-N-methyl-2-(5-methyl-1,2-benzoxazol-3-yl)acetamide
N-(4-bromophenyl)-N-methyl-2-(5-methyl-1,2-benzoxazol-3-yl)acetamide
Compound characteristics
| Compound ID: | E207-0733 |
| Compound Name: | N-(4-bromophenyl)-N-methyl-2-(5-methyl-1,2-benzoxazol-3-yl)acetamide |
| Molecular Weight: | 359.22 |
| Molecular Formula: | C17 H15 Br N2 O2 |
| Smiles: | Cc1ccc2c(c1)c(CC(N(C)c1ccc(cc1)[Br])=O)no2 |
| Stereo: | ACHIRAL |
| logP: | 3.9539 |
| logD: | 3.9539 |
| logSw: | -4.0193 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 37.775 |
| InChI Key: | RSCFVKJLSZOTPP-UHFFFAOYSA-N |