5-[(3,4-dimethoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide
Chemical Structure Depiction of
5-[(3,4-dimethoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide
5-[(3,4-dimethoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide
Compound characteristics
| Compound ID: | E208-1307 |
| Compound Name: | 5-[(3,4-dimethoxyphenyl)methyl]-N-[(4-methylphenyl)methyl]-1,3,4-oxadiazole-2-carboxamide |
| Molecular Weight: | 367.4 |
| Molecular Formula: | C20 H21 N3 O4 |
| Smiles: | Cc1ccc(CNC(c2nnc(Cc3ccc(c(c3)OC)OC)o2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.4278 |
| logD: | 2.4278 |
| logSw: | -2.7916 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.094 |
| InChI Key: | ZPBFHPGHJMKHIW-UHFFFAOYSA-N |