{5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl}[4-(2,4-dimethylphenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
{5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl}[4-(2,4-dimethylphenyl)piperazin-1-yl]methanone
{5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl}[4-(2,4-dimethylphenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | E208-1360 |
| Compound Name: | {5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl}[4-(2,4-dimethylphenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 436.51 |
| Molecular Formula: | C24 H28 N4 O4 |
| Smiles: | Cc1ccc(c(C)c1)N1CCN(CC1)C(c1nnc(Cc2ccc(c(c2)OC)OC)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5643 |
| logD: | 3.5641 |
| logSw: | -3.6681 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 65.288 |
| InChI Key: | RWYLOSKQEWFKOV-UHFFFAOYSA-N |