1-[(4-chlorophenyl)methyl]-4-[(4-methylphenyl)methyl]-1,4-dihydropyrazine-2,3-dione
Chemical Structure Depiction of
1-[(4-chlorophenyl)methyl]-4-[(4-methylphenyl)methyl]-1,4-dihydropyrazine-2,3-dione
1-[(4-chlorophenyl)methyl]-4-[(4-methylphenyl)methyl]-1,4-dihydropyrazine-2,3-dione
Compound characteristics
| Compound ID: | E209-0169 |
| Compound Name: | 1-[(4-chlorophenyl)methyl]-4-[(4-methylphenyl)methyl]-1,4-dihydropyrazine-2,3-dione |
| Molecular Weight: | 340.81 |
| Molecular Formula: | C19 H17 Cl N2 O2 |
| Smiles: | Cc1ccc(CN2C=CN(Cc3ccc(cc3)[Cl])C(C2=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.4325 |
| logD: | 2.4325 |
| logSw: | -2.8985 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.4749 |
| InChI Key: | XGLXUJYPUPJYJX-UHFFFAOYSA-N |