1-[(4-fluorophenyl)methyl]-4-(4-methoxyphenyl)-1,4-dihydropyrazine-2,3-dione
Chemical Structure Depiction of
1-[(4-fluorophenyl)methyl]-4-(4-methoxyphenyl)-1,4-dihydropyrazine-2,3-dione
1-[(4-fluorophenyl)methyl]-4-(4-methoxyphenyl)-1,4-dihydropyrazine-2,3-dione
Compound characteristics
| Compound ID: | E209-1021 |
| Compound Name: | 1-[(4-fluorophenyl)methyl]-4-(4-methoxyphenyl)-1,4-dihydropyrazine-2,3-dione |
| Molecular Weight: | 326.33 |
| Molecular Formula: | C18 H15 F N2 O3 |
| Smiles: | COc1ccc(cc1)N1C=CN(Cc2ccc(cc2)F)C(C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4998 |
| logD: | 1.4998 |
| logSw: | -1.9329 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 38.573 |
| InChI Key: | BUXRGLDFSGBSHV-UHFFFAOYSA-N |