N-cycloheptyl-3-methyl-4-oxo-4,6,7,8-tetrahydropyrrolo[1,2-a]thieno[2,3-d]pyrimidine-2-carboxamide
Chemical Structure Depiction of
N-cycloheptyl-3-methyl-4-oxo-4,6,7,8-tetrahydropyrrolo[1,2-a]thieno[2,3-d]pyrimidine-2-carboxamide
N-cycloheptyl-3-methyl-4-oxo-4,6,7,8-tetrahydropyrrolo[1,2-a]thieno[2,3-d]pyrimidine-2-carboxamide
Compound characteristics
| Compound ID: | E213-0964 |
| Compound Name: | N-cycloheptyl-3-methyl-4-oxo-4,6,7,8-tetrahydropyrrolo[1,2-a]thieno[2,3-d]pyrimidine-2-carboxamide |
| Molecular Weight: | 345.46 |
| Molecular Formula: | C18 H23 N3 O2 S |
| Smiles: | Cc1c2C(N3CCCC3=Nc2sc1C(NC1CCCCCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0844 |
| logD: | 3.0844 |
| logSw: | -3.2643 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.127 |
| InChI Key: | HTCWOSVCGHNPDC-UHFFFAOYSA-N |