ethyl 2-[(6-methyl-2,3-dihydro-4H-1,4-benzoxazine-4-carbonyl)amino]benzoate
Chemical Structure Depiction of
ethyl 2-[(6-methyl-2,3-dihydro-4H-1,4-benzoxazine-4-carbonyl)amino]benzoate
ethyl 2-[(6-methyl-2,3-dihydro-4H-1,4-benzoxazine-4-carbonyl)amino]benzoate
Compound characteristics
| Compound ID: | E216-4857 |
| Compound Name: | ethyl 2-[(6-methyl-2,3-dihydro-4H-1,4-benzoxazine-4-carbonyl)amino]benzoate |
| Molecular Weight: | 340.38 |
| Molecular Formula: | C19 H20 N2 O4 |
| Smiles: | CCOC(c1ccccc1NC(N1CCOc2ccc(C)cc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3295 |
| logD: | 4.3294 |
| logSw: | -4.2406 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.379 |
| InChI Key: | JOCVXXOOIUEROO-UHFFFAOYSA-N |