6-chloro-N-(2,5-dimethoxyphenyl)-2-methyl-2,3-dihydro-4H-1,4-benzoxazine-4-carboxamide
Chemical Structure Depiction of
6-chloro-N-(2,5-dimethoxyphenyl)-2-methyl-2,3-dihydro-4H-1,4-benzoxazine-4-carboxamide
6-chloro-N-(2,5-dimethoxyphenyl)-2-methyl-2,3-dihydro-4H-1,4-benzoxazine-4-carboxamide
Compound characteristics
| Compound ID: | E216-5024 |
| Compound Name: | 6-chloro-N-(2,5-dimethoxyphenyl)-2-methyl-2,3-dihydro-4H-1,4-benzoxazine-4-carboxamide |
| Molecular Weight: | 362.81 |
| Molecular Formula: | C18 H19 Cl N2 O4 |
| Smiles: | CC1CN(C(Nc2cc(ccc2OC)OC)=O)c2cc(ccc2O1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.182 |
| logD: | 4.1819 |
| logSw: | -4.5499 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.897 |
| InChI Key: | ZGLVECYWGRQRNO-LLVKDONJSA-N |