N-(2,3-dimethylcyclohexyl)-7-[(4-fluorophenyl)methyl]-6-methyl-8-oxo-5,6,7,8-tetrahydrofuro[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
Chemical Structure Depiction of
N-(2,3-dimethylcyclohexyl)-7-[(4-fluorophenyl)methyl]-6-methyl-8-oxo-5,6,7,8-tetrahydrofuro[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
N-(2,3-dimethylcyclohexyl)-7-[(4-fluorophenyl)methyl]-6-methyl-8-oxo-5,6,7,8-tetrahydrofuro[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
Compound characteristics
| Compound ID: | E218-0878 |
| Compound Name: | N-(2,3-dimethylcyclohexyl)-7-[(4-fluorophenyl)methyl]-6-methyl-8-oxo-5,6,7,8-tetrahydrofuro[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide |
| Molecular Weight: | 451.54 |
| Molecular Formula: | C26 H30 F N3 O3 |
| Smiles: | CC1CCCC(C1C)NC(C1(C)Cn2c(cc3c2cco3)C(N1Cc1ccc(cc1)F)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.4916 |
| logD: | 4.4916 |
| logSw: | -4.301 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.599 |
| InChI Key: | YYQXSNCTSCFWTE-UHFFFAOYSA-N |