N-cycloheptyl-7-(2,5-dimethylphenyl)-6-methyl-8-oxo-5,6,7,8-tetrahydrofuro[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
Chemical Structure Depiction of
N-cycloheptyl-7-(2,5-dimethylphenyl)-6-methyl-8-oxo-5,6,7,8-tetrahydrofuro[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
N-cycloheptyl-7-(2,5-dimethylphenyl)-6-methyl-8-oxo-5,6,7,8-tetrahydrofuro[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide
Compound characteristics
| Compound ID: | E218-1642 |
| Compound Name: | N-cycloheptyl-7-(2,5-dimethylphenyl)-6-methyl-8-oxo-5,6,7,8-tetrahydrofuro[2',3':4,5]pyrrolo[1,2-a]pyrazine-6-carboxamide |
| Molecular Weight: | 433.55 |
| Molecular Formula: | C26 H31 N3 O3 |
| Smiles: | Cc1ccc(C)c(c1)N1C(c2cc3c(cco3)n2CC1(C)C(NC1CCCCCC1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4357 |
| logD: | 5.4357 |
| logSw: | -5.2767 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.627 |
| InChI Key: | GMRYNQLFCPAZRP-SANMLTNESA-N |