N-(butan-2-yl)-4-(2-phenyl-5,6,7,8-tetrahydrocyclohepta[b]pyrrol-1(4H)-yl)benzamide
Chemical Structure Depiction of
N-(butan-2-yl)-4-(2-phenyl-5,6,7,8-tetrahydrocyclohepta[b]pyrrol-1(4H)-yl)benzamide
N-(butan-2-yl)-4-(2-phenyl-5,6,7,8-tetrahydrocyclohepta[b]pyrrol-1(4H)-yl)benzamide
Compound characteristics
| Compound ID: | E221-1264 |
| Compound Name: | N-(butan-2-yl)-4-(2-phenyl-5,6,7,8-tetrahydrocyclohepta[b]pyrrol-1(4H)-yl)benzamide |
| Molecular Weight: | 386.54 |
| Molecular Formula: | C26 H30 N2 O |
| Smiles: | CCC(C)NC(c1ccc(cc1)n1c(cc2CCCCCc12)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.7501 |
| logD: | 5.7501 |
| logSw: | -5.2658 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.0238 |
| InChI Key: | RDWLAABQDNGZFM-IBGZPJMESA-N |