methyl 1-(2-{[1-(adamantan-1-yl)ethyl]amino}-2-oxoethyl)-5-(furan-2-yl)-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 1-(2-{[1-(adamantan-1-yl)ethyl]amino}-2-oxoethyl)-5-(furan-2-yl)-1H-pyrrole-2-carboxylate
methyl 1-(2-{[1-(adamantan-1-yl)ethyl]amino}-2-oxoethyl)-5-(furan-2-yl)-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | E222-0204 |
| Compound Name: | methyl 1-(2-{[1-(adamantan-1-yl)ethyl]amino}-2-oxoethyl)-5-(furan-2-yl)-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 410.51 |
| Molecular Formula: | C24 H30 N2 O4 |
| Smiles: | CC(C12CC3CC(CC(C3)C2)C1)NC(Cn1c(ccc1c1ccco1)C(=O)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3289 |
| logD: | 4.3289 |
| logSw: | -4.2742 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.591 |
| InChI Key: | DFAUMNJZJMJLKD-KSKOPSKJSA-N |