methyl 5-(furan-2-yl)-1-(2-oxo-2-{[3-(piperidin-1-yl)propyl]amino}ethyl)-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 5-(furan-2-yl)-1-(2-oxo-2-{[3-(piperidin-1-yl)propyl]amino}ethyl)-1H-pyrrole-2-carboxylate
methyl 5-(furan-2-yl)-1-(2-oxo-2-{[3-(piperidin-1-yl)propyl]amino}ethyl)-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | E222-0215 |
| Compound Name: | methyl 5-(furan-2-yl)-1-(2-oxo-2-{[3-(piperidin-1-yl)propyl]amino}ethyl)-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 373.45 |
| Molecular Formula: | C20 H27 N3 O4 |
| Smiles: | COC(c1ccc(c2ccco2)n1CC(NCCCN1CCCCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9523 |
| logD: | -0.7019 |
| logSw: | -2.3435 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.219 |
| InChI Key: | RMKKIVUEVZXKNO-UHFFFAOYSA-N |