2-tert-butyl-N-cycloheptyl-5-[(4-ethoxyphenyl)methyl]-6-methyl-4-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-6-carboxamide
Chemical Structure Depiction of
2-tert-butyl-N-cycloheptyl-5-[(4-ethoxyphenyl)methyl]-6-methyl-4-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-6-carboxamide
2-tert-butyl-N-cycloheptyl-5-[(4-ethoxyphenyl)methyl]-6-methyl-4-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-6-carboxamide
Compound characteristics
| Compound ID: | E224-0776 |
| Compound Name: | 2-tert-butyl-N-cycloheptyl-5-[(4-ethoxyphenyl)methyl]-6-methyl-4-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-6-carboxamide |
| Molecular Weight: | 480.65 |
| Molecular Formula: | C28 H40 N4 O3 |
| Smiles: | CCOc1ccc(CN2C(c3cc(C(C)(C)C)nn3CC2(C)C(NC2CCCCCC2)=O)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6331 |
| logD: | 5.6331 |
| logSw: | -5.2533 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.925 |
| InChI Key: | CSMPZQZRLBABLK-NDEPHWFRSA-N |