2-[(2-chlorophenyl)methyl]-8-methyl-N-(2-phenylethyl)-4,5-dihydro-2H-furo[2,3-g]indazole-7-carboxamide
Chemical Structure Depiction of
2-[(2-chlorophenyl)methyl]-8-methyl-N-(2-phenylethyl)-4,5-dihydro-2H-furo[2,3-g]indazole-7-carboxamide
2-[(2-chlorophenyl)methyl]-8-methyl-N-(2-phenylethyl)-4,5-dihydro-2H-furo[2,3-g]indazole-7-carboxamide
Compound characteristics
| Compound ID: | E233-1975 |
| Compound Name: | 2-[(2-chlorophenyl)methyl]-8-methyl-N-(2-phenylethyl)-4,5-dihydro-2H-furo[2,3-g]indazole-7-carboxamide |
| Molecular Weight: | 445.95 |
| Molecular Formula: | C26 H24 Cl N3 O2 |
| Smiles: | Cc1c2c3c(CCc2oc1C(NCCc1ccccc1)=O)cn(Cc1ccccc1[Cl])n3 |
| Stereo: | ACHIRAL |
| logP: | 4.8287 |
| logD: | 4.8287 |
| logSw: | -4.9607 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.091 |
| InChI Key: | XANVQQUORPVBJM-UHFFFAOYSA-N |