N-cycloheptyl-2-[(2-ethoxyphenyl)methyl]-3-methyl-1-oxo-1,2,3,4-tetrahydropyrazino[1,2-a]indole-3-carboxamide
Chemical Structure Depiction of
N-cycloheptyl-2-[(2-ethoxyphenyl)methyl]-3-methyl-1-oxo-1,2,3,4-tetrahydropyrazino[1,2-a]indole-3-carboxamide
N-cycloheptyl-2-[(2-ethoxyphenyl)methyl]-3-methyl-1-oxo-1,2,3,4-tetrahydropyrazino[1,2-a]indole-3-carboxamide
Compound characteristics
| Compound ID: | E234-1538 |
| Compound Name: | N-cycloheptyl-2-[(2-ethoxyphenyl)methyl]-3-methyl-1-oxo-1,2,3,4-tetrahydropyrazino[1,2-a]indole-3-carboxamide |
| Molecular Weight: | 473.62 |
| Molecular Formula: | C29 H35 N3 O3 |
| Smiles: | CCOc1ccccc1CN1C(c2cc3ccccc3n2CC1(C)C(NC1CCCCCC1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1378 |
| logD: | 6.1378 |
| logSw: | -6.0572 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.278 |
| InChI Key: | GCIOHYXHDQHARG-LJAQVGFWSA-N |